About 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide
2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide (PubChem CID 2815400) has the molecular formula C20H15ClN2O4
and a molecular weight of 382.80 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide |
| PubChem CID | 2815400 |
| Molecular Formula | C20H15ClN2O4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1cccnc1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN2O4/c21-13-3-6-15(7-4-13)27-20-16(2-1-9-22-20)19(24)23-14-5-8-17-18(12-14)26-11-10-25-17/h1-9,12H,10-11H2,(H,23,24) |
| InChIKey | LTNXZSHZHNYBRZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide?
The IUPAC name of 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide (CID 2815400) is 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide.
What is the SMILES notation for 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide?
The canonical SMILES for 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide is O=C(Nc1ccc2c(c1)OCCO2)c1cccnc1Oc1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide?
The InChIKey is LTNXZSHZHNYBRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClN2O4/c21-13-3-6-15(7-4-13)27-20-16(2-1-9-22-20)19(24)23-14-5-8-17-18(12-14)26-11-10-25-17/h1-9,12H,10-11H2,(H,23,24).
What are the key properties of 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide?
2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide has a molecular weight of 382.80 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-3-carboxamide is sourced from PubChem (CID 2815400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).