About 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione
3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione (PubChem CID 2815435) has the molecular formula C24H15NO4
and a molecular weight of 381.39 g/mol. Its IUPAC name is 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione.
Molecular Properties
| Compound Name | 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione |
| PubChem CID | 2815435 |
| Molecular Formula | C24H15NO4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione |
| SMILES | O=C(C1=NOC2(C(=O)c3ccccc3C2=O)C1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H15NO4/c26-21(16-11-5-2-6-12-16)20-19(15-9-3-1-4-10-15)24(29-25-20)22(27)17-13-7-8-14-18(17)23(24)28/h1-14,19H |
| InChIKey | OIEOCNGMVWZUDX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione?
The IUPAC name of 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione (CID 2815435) is 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione.
What is the SMILES notation for 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione?
The canonical SMILES for 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione is O=C(C1=NOC2(C(=O)c3ccccc3C2=O)C1c1ccccc1)c1ccccc1.
What is the InChIKey of 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione?
The InChIKey is OIEOCNGMVWZUDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15NO4/c26-21(16-11-5-2-6-12-16)20-19(15-9-3-1-4-10-15)24(29-25-20)22(27)17-13-7-8-14-18(17)23(24)28/h1-14,19H.
What are the key properties of 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione?
3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione has a molecular weight of 381.39 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione is sourced from PubChem (CID 2815435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).