About 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea
1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea (PubChem CID 2815637) has the molecular formula C19H15N3O2S2
and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea.
Molecular Properties
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea |
| PubChem CID | 2815637 |
| Molecular Formula | C19H15N3O2S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1sccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15N3O2S2/c1-24-15-8-4-2-6-13(15)21-19(23)22-17-12(10-11-25-17)18-20-14-7-3-5-9-16(14)26-18/h2-11H,1H3,(H2,21,22,23) |
| InChIKey | XPRSZXMNSHROBI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea?
The IUPAC name of 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea (CID 2815637) is 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea.
What is the SMILES notation for 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea?
The canonical SMILES for 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea is COc1ccccc1NC(=O)Nc1sccc1-c1nc2ccccc2s1.
What is the InChIKey of 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea?
The InChIKey is XPRSZXMNSHROBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2S2/c1-24-15-8-4-2-6-13(15)21-19(23)22-17-12(10-11-25-17)18-20-14-7-3-5-9-16(14)26-18/h2-11H,1H3,(H2,21,22,23).
What are the key properties of 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea?
1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea has a molecular weight of 381.48 g/mol, XLogP of 5.68, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-3-(2-methoxyphenyl)urea is sourced from PubChem (CID 2815637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).