About 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide
1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 2815815) has the molecular formula C20H18N4O4S
and a molecular weight of 410.46 g/mol. Its IUPAC name is 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide |
| PubChem CID | 2815815 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | N#Cc1cccc(C#N)c1Oc1ccc(S(=O)(=O)N2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C20H18N4O4S/c21-12-15-2-1-3-16(13-22)19(15)28-17-4-6-18(7-5-17)29(26,27)24-10-8-14(9-11-24)20(23)25/h1-7,14H,8-11H2,(H2,23,25) |
| InChIKey | YDIXEQGVTHDVHP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 137.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide?
The IUPAC name of 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide (CID 2815815) is 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide.
What is the SMILES notation for 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide?
The canonical SMILES for 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide is N#Cc1cccc(C#N)c1Oc1ccc(S(=O)(=O)N2CCC(C(N)=O)CC2)cc1.
What is the InChIKey of 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide?
The InChIKey is YDIXEQGVTHDVHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O4S/c21-12-15-2-1-3-16(13-22)19(15)28-17-4-6-18(7-5-17)29(26,27)24-10-8-14(9-11-24)20(23)25/h1-7,14H,8-11H2,(H2,23,25).
What are the key properties of 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide?
1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide has a molecular weight of 410.46 g/mol, XLogP of 2.11, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,6-dicyanophenoxy)phenyl]sulfonylpiperidine-4-carboxamide is sourced from PubChem (CID 2815815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).