C9H8ClN3 — CID 2815832
3-(3-chlorophenyl)-5-methyl-1H-1,2,4-triazole (PubChem CID 2815832) has the molecular formula C9H8ClN3 and a molecular weight of 193.64 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-(3-chlorophenyl)-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 2815832 |
| Molecular Formula | C9H8ClN3 |
| Molecular Weight | 193.64 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 3-(3-chlorophenyl)-5-methyl-1H-1,2,4-triazole |
| SMILES | Cc1nc(-c2cccc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C9H8ClN3/c1-6-11-9(13-12-6)7-3-2-4-8(10)5-7/h2-5H,1H3,(H,11,12,13) |
| InChIKey | PLYDTIORJVVJBJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.64 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |