C21H21ClN4O2 — CID 2815864
[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-(5-methyl-2-phenyltriazol-4-yl)methanone (PubChem CID 2815864) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-(5-methyl-2-phenyltriazol-4-yl)methanone.
| Compound Name | [4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-(5-methyl-2-phenyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 2815864 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-(5-methyl-2-phenyltriazol-4-yl)methanone |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)N1CCC(O)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H21ClN4O2/c1-15-19(24-26(23-15)18-5-3-2-4-6-18)20(27)25-13-11-21(28,12-14-25)16-7-9-17(22)10-8-16/h2-10,28H,11-14H2,1H3 |
| InChIKey | WOKREELBTKSZQM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |