About (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate
(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate (PubChem CID 2815878) has the molecular formula C17H14ClNO3
and a molecular weight of 315.76 g/mol. Its IUPAC name is (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate.
Molecular Properties
| Compound Name | (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate |
| PubChem CID | 2815878 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate |
| SMILES | O=C(OCC1CC(c2ccccc2)=NO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClNO3/c18-14-8-6-13(7-9-14)17(20)21-11-15-10-16(19-22-15)12-4-2-1-3-5-12/h1-9,15H,10-11H2 |
| InChIKey | ZYWUXXOYNZPGBY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate?
The IUPAC name of (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate (CID 2815878) is (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate.
What is the SMILES notation for (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate?
The canonical SMILES for (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate is O=C(OCC1CC(c2ccccc2)=NO1)c1ccc(Cl)cc1.
What is the InChIKey of (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate?
The InChIKey is ZYWUXXOYNZPGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClNO3/c18-14-8-6-13(7-9-14)17(20)21-11-15-10-16(19-22-15)12-4-2-1-3-5-12/h1-9,15H,10-11H2.
What are the key properties of (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate?
(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate has a molecular weight of 315.76 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-chlorobenzoate is sourced from PubChem (CID 2815878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).