About 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline
4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline (PubChem CID 2816002) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline.
Molecular Properties
| Compound Name | 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline |
| PubChem CID | 2816002 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline |
| SMILES | Cc1nc2c(C)cccc2c2c1COC2 |
| InChI | InChI=1S/C13H13NO/c1-8-4-3-5-10-12-7-15-6-11(12)9(2)14-13(8)10/h3-5H,6-7H2,1-2H3 |
| InChIKey | NOVQTADMBRJFMW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline?
The IUPAC name of 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline (CID 2816002) is 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline.
What is the SMILES notation for 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline?
The canonical SMILES for 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline is Cc1nc2c(C)cccc2c2c1COC2.
What is the InChIKey of 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline?
The InChIKey is NOVQTADMBRJFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c1-8-4-3-5-10-12-7-15-6-11(12)9(2)14-13(8)10/h3-5H,6-7H2,1-2H3.
What are the key properties of 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline?
4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline has a molecular weight of 199.25 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1,3-dihydrofuro[3,4-c]quinoline is sourced from PubChem (CID 2816002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).