C24H15N3O3S — CID 2816228
(4E)-4-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)-3-phenyl-1,2-oxazol-5-one (PubChem CID 2816228) has the molecular formula C24H15N3O3S and a molecular weight of 425.47 g/mol. Its IUPAC name is (4E)-4-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)-3-phenyl-1,2-oxazol-5-one.
| Compound Name | (4E)-4-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 2816228 |
| Molecular Formula | C24H15N3O3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | (4E)-4-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)-3-phenyl-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccccc2)/C1=C1\SC(C(=O)c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C24H15N3O3S/c28-21(17-12-6-2-7-13-17)22-25-27(18-14-8-3-9-15-18)23(31-22)19-20(26-30-24(19)29)16-10-4-1-5-11-16/h1-15H/b23-19+ |
| InChIKey | XWDWAQQYAOCWQI-FCDQGJHFSA-N |
| XLogP | 4.61 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|