About 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile
4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile (PubChem CID 2816450) has the molecular formula C19H11ClN2O2
and a molecular weight of 334.76 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile |
| PubChem CID | 2816450 |
| Molecular Formula | C19H11ClN2O2 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2Cl)c2c([nH]c1=O)-c1ccccc1OC2 |
| InChI | InChI=1S/C19H11ClN2O2/c20-15-7-3-1-5-11(15)17-13(9-21)19(23)22-18-12-6-2-4-8-16(12)24-10-14(17)18/h1-8H,10H2,(H,22,23) |
| InChIKey | SGRUPDAVNVZWDX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile?
The IUPAC name of 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile (CID 2816450) is 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile.
What is the SMILES notation for 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile?
The canonical SMILES for 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile is N#Cc1c(-c2ccccc2Cl)c2c([nH]c1=O)-c1ccccc1OC2.
What is the InChIKey of 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile?
The InChIKey is SGRUPDAVNVZWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClN2O2/c20-15-7-3-1-5-11(15)17-13(9-21)19(23)22-18-12-6-2-4-8-16(12)24-10-14(17)18/h1-8H,10H2,(H,22,23).
What are the key properties of 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile?
4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile has a molecular weight of 334.76 g/mol, XLogP of 4.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorophenyl)-2-oxo-1,5-dihydrochromeno[4,3-b]pyridine-3-carbonitrile is sourced from PubChem (CID 2816450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).