C21H13NO5 — CID 2816529
(4,8-dioxo-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaen-6-yl) benzoate (PubChem CID 2816529) has the molecular formula C21H13NO5 and a molecular weight of 359.34 g/mol. Its IUPAC name is (4,8-dioxo-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaen-6-yl) benzoate.
| Compound Name | (4,8-dioxo-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaen-6-yl) benzoate |
|---|---|
| PubChem CID | 2816529 |
| Molecular Formula | C21H13NO5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (4,8-dioxo-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaen-6-yl) benzoate |
| SMILES | O=C(Oc1cc(=O)oc2c1c(=O)n1c3c(cccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H13NO5/c23-16-11-15(26-21(25)13-5-2-1-3-6-13)17-19(27-16)14-8-4-7-12-9-10-22(18(12)14)20(17)24/h1-8,11H,9-10H2 |
| InChIKey | JFXJPALAKOIIEH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|