C18H11N3OS3 — CID 2816630
5-phenyl-12-thiophen-2-yl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one (PubChem CID 2816630) has the molecular formula C18H11N3OS3 and a molecular weight of 381.51 g/mol. Its IUPAC name is 5-phenyl-12-thiophen-2-yl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one.
| Compound Name | 5-phenyl-12-thiophen-2-yl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one |
|---|---|
| PubChem CID | 2816630 |
| Molecular Formula | C18H11N3OS3 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 5-phenyl-12-thiophen-2-yl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one |
| SMILES | O=c1c2cc(-c3ccccc3)sc2nc2n1N=C(c1cccs1)CS2 |
| InChI | InChI=1S/C18H11N3OS3/c22-17-12-9-15(11-5-2-1-3-6-11)25-16(12)19-18-21(17)20-13(10-24-18)14-7-4-8-23-14/h1-9H,10H2 |
| InChIKey | GQQPMUYWTCMFEK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |