C10H7N3O2S — CID 2816635
2-methyl-[1,2,4]triazino[3,4-b][1,3]benzothiazole-3,4-dione (PubChem CID 2816635) has the molecular formula C10H7N3O2S and a molecular weight of 233.25 g/mol. Its IUPAC name is 2-methyl-[1,2,4]triazino[3,4-b][1,3]benzothiazole-3,4-dione.
| Compound Name | 2-methyl-[1,2,4]triazino[3,4-b][1,3]benzothiazole-3,4-dione |
|---|---|
| PubChem CID | 2816635 |
| Molecular Formula | C10H7N3O2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2-methyl-[1,2,4]triazino[3,4-b][1,3]benzothiazole-3,4-dione |
| SMILES | Cn1nc2sc3ccccc3n2c(=O)c1=O |
| InChI | InChI=1S/C10H7N3O2S/c1-12-8(14)9(15)13-6-4-2-3-5-7(6)16-10(13)11-12/h2-5H,1H3 |
| InChIKey | WLJWUSAHTZLQIW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 56.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|