About N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide
N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide (PubChem CID 2816675) has the molecular formula C16H19ClN4O4
and a molecular weight of 366.81 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide.
Molecular Properties
| Compound Name | N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide |
| PubChem CID | 2816675 |
| Molecular Formula | C16H19ClN4O4 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)NN1CC(=O)N(c2ccc(Cl)cc2)CC1=O |
| InChI | InChI=1S/C16H19ClN4O4/c17-12-1-3-13(4-2-12)20-10-16(24)21(11-15(20)23)18-14(22)9-19-5-7-25-8-6-19/h1-4H,5-11H2,(H,18,22) |
| InChIKey | LSKONXAFHVYCCC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide?
The IUPAC name of N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide (CID 2816675) is N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide.
What is the SMILES notation for N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide?
The canonical SMILES for N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide is O=C(CN1CCOCC1)NN1CC(=O)N(c2ccc(Cl)cc2)CC1=O.
What is the InChIKey of N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide?
The InChIKey is LSKONXAFHVYCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN4O4/c17-12-1-3-13(4-2-12)20-10-16(24)21(11-15(20)23)18-14(22)9-19-5-7-25-8-6-19/h1-4H,5-11H2,(H,18,22).
What are the key properties of N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide?
N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide has a molecular weight of 366.81 g/mol, XLogP of -0.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-chlorophenyl)-2,5-dioxopiperazin-1-yl]-2-morpholin-4-ylacetamide is sourced from PubChem (CID 2816675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).