C19H17N3O2S — CID 2816682
3,5-dimethyl-11-(4-methylphenyl)-8-thia-6,11,14-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene-10,13-dione (PubChem CID 2816682) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3,5-dimethyl-11-(4-methylphenyl)-8-thia-6,11,14-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene-10,13-dione.
| Compound Name | 3,5-dimethyl-11-(4-methylphenyl)-8-thia-6,11,14-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene-10,13-dione |
|---|---|
| PubChem CID | 2816682 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3,5-dimethyl-11-(4-methylphenyl)-8-thia-6,11,14-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene-10,13-dione |
| SMILES | Cc1ccc(N2CC(=O)Nc3c(sc4nc(C)cc(C)c34)C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O2S/c1-10-4-6-13(7-5-10)22-9-14(23)21-16-15-11(2)8-12(3)20-18(15)25-17(16)19(22)24/h4-8H,9H2,1-3H3,(H,21,23) |
| InChIKey | CIRVNSRBCMRDJD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |