C21H20N2O4 — CID 2816818
ethyl 2-[4-[(4-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetate (PubChem CID 2816818) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is ethyl 2-[4-[(4-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(4-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 2816818 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | ethyl 2-[4-[(4-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=Cc2ccc(OC)cc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C21H20N2O4/c1-3-27-19(24)14-23-20(16-7-5-4-6-8-16)22-18(21(23)25)13-15-9-11-17(26-2)12-10-15/h4-13H,3,14H2,1-2H3 |
| InChIKey | VXOISKMERPJXBH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|