C19H12N2O4S — CID 2816952
15-methyl-11-thiophen-2-yl-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17),15-hexaene-9,13-dione (PubChem CID 2816952) has the molecular formula C19H12N2O4S and a molecular weight of 364.38 g/mol. Its IUPAC name is 15-methyl-11-thiophen-2-yl-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17),15-hexaene-9,13-dione.
| Compound Name | 15-methyl-11-thiophen-2-yl-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17),15-hexaene-9,13-dione |
|---|---|
| PubChem CID | 2816952 |
| Molecular Formula | C19H12N2O4S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 15-methyl-11-thiophen-2-yl-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17),15-hexaene-9,13-dione |
| SMILES | Cc1nc2c(c(=O)[nH]1)C(c1cccs1)c1c(c3ccccc3oc1=O)O2 |
| InChI | InChI=1S/C19H12N2O4S/c1-9-20-17(22)15-13(12-7-4-8-26-12)14-16(25-18(15)21-9)10-5-2-3-6-11(10)24-19(14)23/h2-8,13H,1H3,(H,20,21,22) |
| InChIKey | XANUAGOFEOUBAP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|