About ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate
ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate (PubChem CID 2817002) has the molecular formula C20H20FN3O4
and a molecular weight of 385.40 g/mol. Its IUPAC name is ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate.
Molecular Properties
| Compound Name | ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate |
| PubChem CID | 2817002 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)COc1nc(C)cc(C)c1C#N)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FN3O4/c1-4-27-19(26)11-24(16-7-5-15(21)6-8-16)18(25)12-28-20-17(10-22)13(2)9-14(3)23-20/h5-9H,4,11-12H2,1-3H3 |
| InChIKey | VDSHBUMMJCVQRC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate?
The IUPAC name of ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate (CID 2817002) is ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate.
What is the SMILES notation for ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate?
The canonical SMILES for ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate is CCOC(=O)CN(C(=O)COc1nc(C)cc(C)c1C#N)c1ccc(F)cc1.
What is the InChIKey of ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate?
The InChIKey is VDSHBUMMJCVQRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FN3O4/c1-4-27-19(26)11-24(16-7-5-15(21)6-8-16)18(25)12-28-20-17(10-22)13(2)9-14(3)23-20/h5-9H,4,11-12H2,1-3H3.
What are the key properties of ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate?
ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate has a molecular weight of 385.40 g/mol, XLogP of 2.68, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(N-[2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]acetyl]-4-fluoroanilino)acetate is sourced from PubChem (CID 2817002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).