About 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one
5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one (PubChem CID 2817083) has the molecular formula C23H15N3OS
and a molecular weight of 381.46 g/mol. Its IUPAC name is 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one.
Molecular Properties
| Compound Name | 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one |
| PubChem CID | 2817083 |
| Molecular Formula | C23H15N3OS |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one |
| SMILES | O=c1c(=Cc2cccnc2)sc2nc(-c3ccccc3)c(-c3ccccc3)n12 |
| InChI | InChI=1S/C23H15N3OS/c27-22-19(14-16-8-7-13-24-15-16)28-23-25-20(17-9-3-1-4-10-17)21(26(22)23)18-11-5-2-6-12-18/h1-15H |
| InChIKey | HSXWAMBEHDBSJD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one?
The IUPAC name of 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one (CID 2817083) is 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one.
What is the SMILES notation for 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one?
The canonical SMILES for 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one is O=c1c(=Cc2cccnc2)sc2nc(-c3ccccc3)c(-c3ccccc3)n12.
What is the InChIKey of 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one?
The InChIKey is HSXWAMBEHDBSJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15N3OS/c27-22-19(14-16-8-7-13-24-15-16)28-23-25-20(17-9-3-1-4-10-17)21(26(22)23)18-11-5-2-6-12-18/h1-15H.
What are the key properties of 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one?
5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one has a molecular weight of 381.46 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diphenyl-2-(pyridin-3-ylmethylidene)imidazo[2,1-b][1,3]thiazol-3-one is sourced from PubChem (CID 2817083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).