About N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide
N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide (PubChem CID 2817120) has the molecular formula C23H21N3O3S
and a molecular weight of 419.51 g/mol. Its IUPAC name is N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide |
| PubChem CID | 2817120 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(c2ccccc2)CC1)Nc1scc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C23H21N3O3S/c27-20(14-25-10-12-26(13-11-25)16-6-2-1-3-7-16)24-22-21-18(15-30-22)17-8-4-5-9-19(17)29-23(21)28/h1-9,15H,10-14H2,(H,24,27) |
| InChIKey | SWUSTYUKWHBDOQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide?
The IUPAC name of N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide (CID 2817120) is N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide.
What is the SMILES notation for N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide?
The canonical SMILES for N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide is O=C(CN1CCN(c2ccccc2)CC1)Nc1scc2c1c(=O)oc1ccccc12.
What is the InChIKey of N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide?
The InChIKey is SWUSTYUKWHBDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O3S/c27-20(14-25-10-12-26(13-11-25)16-6-2-1-3-7-16)24-22-21-18(15-30-22)17-8-4-5-9-19(17)29-23(21)28/h1-9,15H,10-14H2,(H,24,27).
What are the key properties of N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide?
N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide has a molecular weight of 419.51 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-oxothieno[3,4-c]chromen-3-yl)-2-(4-phenylpiperazin-1-yl)acetamide is sourced from PubChem (CID 2817120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).