C14H19N5OS2 — CID 2817154
2-[[3-(ethylamino)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]acetamide (PubChem CID 2817154) has the molecular formula C14H19N5OS2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[[3-(ethylamino)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]acetamide.
| Compound Name | 2-[[3-(ethylamino)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2817154 |
| Molecular Formula | C14H19N5OS2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[[3-(ethylamino)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]acetamide |
| SMILES | CCNc1nc(SCC(N)=O)nc2sc3c(c12)CCN(C)C3 |
| InChI | InChI=1S/C14H19N5OS2/c1-3-16-12-11-8-4-5-19(2)6-9(8)22-13(11)18-14(17-12)21-7-10(15)20/h3-7H2,1-2H3,(H2,15,20)(H,16,17,18) |
| InChIKey | VTRFYCAOKBNLIC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |