C19H21ClN4S2 — CID 2817156
5-[(4-chlorophenyl)methylsulfanyl]-N-ethyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 2817156) has the molecular formula C19H21ClN4S2 and a molecular weight of 404.99 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylsulfanyl]-N-ethyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 5-[(4-chlorophenyl)methylsulfanyl]-N-ethyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 2817156 |
| Molecular Formula | C19H21ClN4S2 |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 5-[(4-chlorophenyl)methylsulfanyl]-N-ethyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CCNc1nc(SCc2ccc(Cl)cc2)nc2sc3c(c12)CCN(C)C3 |
| InChI | InChI=1S/C19H21ClN4S2/c1-3-21-17-16-14-8-9-24(2)10-15(14)26-18(16)23-19(22-17)25-11-12-4-6-13(20)7-5-12/h4-7H,3,8-11H2,1-2H3,(H,21,22,23) |
| InChIKey | DRFKXKZJRZEGFR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |