C9H20O4S2 — CID 2817253
(2R,3R,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol (PubChem CID 2817253) has the molecular formula C9H20O4S2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (2R,3R,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 2817253 |
| Molecular Formula | C9H20O4S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (2R,3R,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol |
| SMILES | CCSC(SCC)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H20O4S2/c1-3-14-9(15-4-2)8(13)7(12)6(11)5-10/h6-13H,3-5H2,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | IZQLWYVNJTUXNP-PRJMDXOYSA-N |
| XLogP | -0.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|