About 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile
2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile (PubChem CID 2817302) has the molecular formula C20H14N2O
and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
| PubChem CID | 2817302 |
| Molecular Formula | C20H14N2O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(c2ccccc2)C2=C(N1)c1ccccc1C2=O |
| InChI | InChI=1S/C20H14N2O/c1-12-16(11-21)17(13-7-3-2-4-8-13)18-19(22-12)14-9-5-6-10-15(14)20(18)23/h2-10,17,22H,1H3 |
| InChIKey | DJULTALVBVQFSS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
The IUPAC name of 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile (CID 2817302) is 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile.
What is the SMILES notation for 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
The canonical SMILES for 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile is CC1=C(C#N)C(c2ccccc2)C2=C(N1)c1ccccc1C2=O.
What is the InChIKey of 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
The InChIKey is DJULTALVBVQFSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O/c1-12-16(11-21)17(13-7-3-2-4-8-13)18-19(22-12)14-9-5-6-10-15(14)20(18)23/h2-10,17,22H,1H3.
What are the key properties of 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile has a molecular weight of 298.35 g/mol, XLogP of 3.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-oxo-4-phenyl-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile is sourced from PubChem (CID 2817302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).