About 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile
3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile (PubChem CID 2817317) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile |
| PubChem CID | 2817317 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile |
| SMILES | N#CCCn1c2c(ccc1=O)CCCC2 |
| InChI | InChI=1S/C12H14N2O/c13-8-3-9-14-11-5-2-1-4-10(11)6-7-12(14)15/h6-7H,1-5,9H2 |
| InChIKey | WJIPDPMOSRIOEJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile?
The IUPAC name of 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile (CID 2817317) is 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile.
What is the SMILES notation for 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile?
The canonical SMILES for 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile is N#CCCn1c2c(ccc1=O)CCCC2.
What is the InChIKey of 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile?
The InChIKey is WJIPDPMOSRIOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c13-8-3-9-14-11-5-2-1-4-10(11)6-7-12(14)15/h6-7H,1-5,9H2.
What are the key properties of 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile?
3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile has a molecular weight of 202.26 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxo-5,6,7,8-tetrahydroquinolin-1-yl)propanenitrile is sourced from PubChem (CID 2817317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).