C33H35NO9 — CID 2817438
[(2R,3S,4R,5R,6R)-5-acetamido-4,6-diacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate (PubChem CID 2817438) has the molecular formula C33H35NO9 and a molecular weight of 589.64 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-4,6-diacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-4,6-diacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 2817438 |
| Molecular Formula | C33H35NO9 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-4,6-diacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)N[C@H]1[C@@H](OC(C)=O)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H35NO9/c1-21(35)34-29-31(41-23(3)37)30(40-22(2)36)28(43-32(29)42-24(4)38)20-39-33(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,28-32H,20H2,1-4H3,(H,34,35)/t28-,29-,30-,31-,32+/m1/s1 |
| InChIKey | SDKBHKMVFPXAOA-ROQXEPJXSA-N |
| XLogP | 3.65 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|