C11H11F6N3O3S — CID 2817490
N-[1,1,1,3,3,3-hexafluoro-2-(4-sulfamoylanilino)propan-2-yl]acetamide (PubChem CID 2817490) has the molecular formula C11H11F6N3O3S and a molecular weight of 379.28 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(4-sulfamoylanilino)propan-2-yl]acetamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(4-sulfamoylanilino)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 2817490 |
| Molecular Formula | C11H11F6N3O3S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(4-sulfamoylanilino)propan-2-yl]acetamide |
| SMILES | CC(=O)NC(Nc1ccc(S(N)(=O)=O)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H11F6N3O3S/c1-6(21)19-9(10(12,13)14,11(15,16)17)20-7-2-4-8(5-3-7)24(18,22)23/h2-5,20H,1H3,(H,19,21)(H2,18,22,23) |
| InChIKey | BVDZOISAJYQTDX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|