C22H16N2O4 — CID 2817496
3-(4-nitrophenyl)-5-(2-phenylmethoxyphenyl)-1,2-oxazole (PubChem CID 2817496) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-5-(2-phenylmethoxyphenyl)-1,2-oxazole.
| Compound Name | 3-(4-nitrophenyl)-5-(2-phenylmethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 2817496 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-(4-nitrophenyl)-5-(2-phenylmethoxyphenyl)-1,2-oxazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(-c3ccccc3OCc3ccccc3)on2)cc1 |
| InChI | InChI=1S/C22H16N2O4/c25-24(26)18-12-10-17(11-13-18)20-14-22(28-23-20)19-8-4-5-9-21(19)27-15-16-6-2-1-3-7-16/h1-14H,15H2 |
| InChIKey | RVBJFZWOYZEMFM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|