C23H21N3O3 — CID 2817565
6-ethyl-5,8-dimethyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 2817565) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 6-ethyl-5,8-dimethyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 6-ethyl-5,8-dimethyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 2817565 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 6-ethyl-5,8-dimethyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | CCc1c(C)c2c(=O)n(-c3ccccc3)c(=O)n(-c3ccccc3)c2n(C)c1=O |
| InChI | InChI=1S/C23H21N3O3/c1-4-18-15(2)19-20(24(3)21(18)27)25(16-11-7-5-8-12-16)23(29)26(22(19)28)17-13-9-6-10-14-17/h5-14H,4H2,1-3H3 |
| InChIKey | JCIGDEGHLPQBJC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |