C27H21N3O3 — CID 2817566
5,8-dimethyl-1,3,6-triphenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 2817566) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is 5,8-dimethyl-1,3,6-triphenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5,8-dimethyl-1,3,6-triphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 2817566 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 5,8-dimethyl-1,3,6-triphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cc1c(-c2ccccc2)c(=O)n(C)c2c1c(=O)n(-c1ccccc1)c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C27H21N3O3/c1-18-22(19-12-6-3-7-13-19)25(31)28(2)24-23(18)26(32)30(21-16-10-5-11-17-21)27(33)29(24)20-14-8-4-9-15-20/h3-17H,1-2H3 |
| InChIKey | JUCWJXHVDRKDCT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |