C16H20O8S2 — CID 2817567
diethyl 1,1,3,3-tetraoxo-5-phenyl-1,3-dithiane-4,6-dicarboxylate (PubChem CID 2817567) has the molecular formula C16H20O8S2 and a molecular weight of 404.46 g/mol. Its IUPAC name is diethyl 1,1,3,3-tetraoxo-5-phenyl-1,3-dithiane-4,6-dicarboxylate.
| Compound Name | diethyl 1,1,3,3-tetraoxo-5-phenyl-1,3-dithiane-4,6-dicarboxylate |
|---|---|
| PubChem CID | 2817567 |
| Molecular Formula | C16H20O8S2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | diethyl 1,1,3,3-tetraoxo-5-phenyl-1,3-dithiane-4,6-dicarboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)C(C(=O)OCC)S(=O)(=O)CS1(=O)=O |
| InChI | InChI=1S/C16H20O8S2/c1-3-23-15(17)13-12(11-8-6-5-7-9-11)14(16(18)24-4-2)26(21,22)10-25(13,19)20/h5-9,12-14H,3-4,10H2,1-2H3 |
| InChIKey | GWNSGZCPLVAUFS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |