C13H13F6NO2 — CID 2817601
N-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)benzamide (PubChem CID 2817601) has the molecular formula C13H13F6NO2 and a molecular weight of 329.24 g/mol. Its IUPAC name is N-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)benzamide.
| Compound Name | N-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 2817601 |
| Molecular Formula | C13H13F6NO2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)benzamide |
| SMILES | CC(C)OC(NC(=O)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F6NO2/c1-8(2)22-11(12(14,15)16,13(17,18)19)20-10(21)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,20,21) |
| InChIKey | HEUUPQGDXXMBGI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|