About 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea
1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea (PubChem CID 2817615) has the molecular formula C18H18FN3OS
and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea.
Molecular Properties
| Compound Name | 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea |
| PubChem CID | 2817615 |
| Molecular Formula | C18H18FN3OS |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea |
| SMILES | CC1(C)CN=C(N(C(=O)Nc2ccccc2)c2ccccc2F)S1 |
| InChI | InChI=1S/C18H18FN3OS/c1-18(2)12-20-17(24-18)22(15-11-7-6-10-14(15)19)16(23)21-13-8-4-3-5-9-13/h3-11H,12H2,1-2H3,(H,21,23) |
| InChIKey | IHTIZRQXLNRVPB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea?
The IUPAC name of 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea (CID 2817615) is 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea.
What is the SMILES notation for 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea?
The canonical SMILES for 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea is CC1(C)CN=C(N(C(=O)Nc2ccccc2)c2ccccc2F)S1.
What is the InChIKey of 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea?
The InChIKey is IHTIZRQXLNRVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN3OS/c1-18(2)12-20-17(24-18)22(15-11-7-6-10-14(15)19)16(23)21-13-8-4-3-5-9-13/h3-11H,12H2,1-2H3,(H,21,23).
What are the key properties of 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea?
1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea has a molecular weight of 343.43 g/mol, XLogP of 4.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-1-(2-fluorophenyl)-3-phenylurea is sourced from PubChem (CID 2817615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).