C18H23N5NaO8P — CID 28177
CID 28177 (PubChem CID 28177) has the molecular formula C18H23N5NaO8P and a molecular weight of 491.40 g/mol. Its IUPAC name is sodium [(3aR,4R,6R,6aR)-4-[6-(butanoylamino)purin-9-yl]-2-oxido-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methyl butanoate.
| Compound Name | CID 28177 |
|---|---|
| PubChem CID | 28177 |
| Molecular Formula | C18H23N5NaO8P |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | sodium [(3aR,4R,6R,6aR)-4-[6-(butanoylamino)purin-9-yl]-2-oxido-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methyl butanoate |
| SMILES | CCCC(=O)NC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@H]4[C@@H]([C@H](O3)COC(=O)CCC)OP(=O)(O4)[O-].[Na+] |
| InChIKey | BTRTVLHHULOPFJ-JBVYASIDSA-M |
| XLogP | N/A |
| TPSA | 167.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | 751 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|