About 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide
2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide (PubChem CID 2817749) has the molecular formula C19H15IN2O2
and a molecular weight of 430.25 g/mol. Its IUPAC name is 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide.
Molecular Properties
| Compound Name | 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide |
| PubChem CID | 2817749 |
| Molecular Formula | C19H15IN2O2 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide |
| SMILES | Cc1n(-c2ccccc2)c2c([n+]1C)C(=O)c1ccccc1C2=O.[I-] |
| InChI | InChI=1S/C19H15N2O2.HI/c1-12-20(2)16-17(21(12)13-8-4-3-5-9-13)19(23)15-11-7-6-10-14(15)18(16)22;/h3-11H,1-2H3;1H/q+1;/p-1 |
| InChIKey | FDBDJQXBYBXQFM-UHFFFAOYSA-M |
| XLogP | -0.61 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide?
The IUPAC name of 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide (CID 2817749) is 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide.
What is the SMILES notation for 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide?
The canonical SMILES for 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide is Cc1n(-c2ccccc2)c2c([n+]1C)C(=O)c1ccccc1C2=O.[I-].
What is the InChIKey of 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide?
The InChIKey is FDBDJQXBYBXQFM-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H15N2O2.HI/c1-12-20(2)16-17(21(12)13-8-4-3-5-9-13)19(23)15-11-7-6-10-14(15)18(16)22;/h3-11H,1-2H3;1H/q+1;/p-1.
What are the key properties of 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide?
2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide has a molecular weight of 430.25 g/mol, XLogP of -0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1-phenylbenzo[f]benzimidazol-3-ium-4,9-dione iodide is sourced from PubChem (CID 2817749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).