C13H11F6N3O2 — CID 2817881
N-[1,1,1,3,3,3-hexafluoro-2-(2-oxopyrrolidin-1-yl)propan-2-yl]pyridine-3-carboxamide (PubChem CID 2817881) has the molecular formula C13H11F6N3O2 and a molecular weight of 355.24 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(2-oxopyrrolidin-1-yl)propan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(2-oxopyrrolidin-1-yl)propan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2817881 |
| Molecular Formula | C13H11F6N3O2 |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(2-oxopyrrolidin-1-yl)propan-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC(N1CCCC1=O)(C(F)(F)F)C(F)(F)F)c1cccnc1 |
| InChI | InChI=1S/C13H11F6N3O2/c14-12(15,16)11(13(17,18)19,22-6-2-4-9(22)23)21-10(24)8-3-1-5-20-7-8/h1,3,5,7H,2,4,6H2,(H,21,24) |
| InChIKey | ONAIXHRKJGBOKX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |