C15H19F3N2O3 — CID 2817882
ethyl 2-acetamido-3,3,3-trifluoro-2-(2-phenylethylamino)propanoate (PubChem CID 2817882) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is ethyl 2-acetamido-3,3,3-trifluoro-2-(2-phenylethylamino)propanoate.
| Compound Name | ethyl 2-acetamido-3,3,3-trifluoro-2-(2-phenylethylamino)propanoate |
|---|---|
| PubChem CID | 2817882 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 2-acetamido-3,3,3-trifluoro-2-(2-phenylethylamino)propanoate |
| SMILES | CCOC(=O)C(NCCc1ccccc1)(NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O3/c1-3-23-13(22)14(15(16,17)18,20-11(2)21)19-10-9-12-7-5-4-6-8-12/h4-8,19H,3,9-10H2,1-2H3,(H,20,21) |
| InChIKey | YNFNHMQHWOZSAK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|