About 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate
2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate (PubChem CID 2817950) has the molecular formula C18H19Cl2NO5
and a molecular weight of 400.26 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate.
Molecular Properties
| Compound Name | 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
| PubChem CID | 2817950 |
| Molecular Formula | C18H19Cl2NO5 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
| SMILES | CCOCCOC(=O)C(C)Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2NO5/c1-3-23-8-9-24-18(22)12(2)25-14-4-6-15(7-5-14)26-17-16(20)10-13(19)11-21-17/h4-7,10-12H,3,8-9H2,1-2H3 |
| InChIKey | PRWWGGNUCSSALR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
The IUPAC name of 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate (CID 2817950) is 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate.
What is the SMILES notation for 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
The canonical SMILES for 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate is CCOCCOC(=O)C(C)Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1.
What is the InChIKey of 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
The InChIKey is PRWWGGNUCSSALR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl2NO5/c1-3-23-8-9-24-18(22)12(2)25-14-4-6-15(7-5-14)26-17-16(20)10-13(19)11-21-17/h4-7,10-12H,3,8-9H2,1-2H3.
What are the key properties of 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate has a molecular weight of 400.26 g/mol, XLogP of 4.53, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate is sourced from PubChem (CID 2817950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).