About tricyclo[6.3.3.01,8]tetradecane-10,13-dione
tricyclo[6.3.3.01,8]tetradecane-10,13-dione (PubChem CID 2817973) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is tricyclo[6.3.3.01,8]tetradecane-10,13-dione.
Molecular Properties
| Compound Name | tricyclo[6.3.3.01,8]tetradecane-10,13-dione |
| PubChem CID | 2817973 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | tricyclo[6.3.3.01,8]tetradecane-10,13-dione |
| SMILES | O=C1CC23CCCCCCC2(C1)CC(=O)C3 |
| InChI | InChI=1S/C14H20O2/c15-11-7-13-5-3-1-2-4-6-14(13,9-11)10-12(16)8-13/h1-10H2 |
| InChIKey | PCXASZHJUJHLRY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tricyclo[6.3.3.01,8]tetradecane-10,13-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.3.3.01,8]tetradecane-10,13-dione?
The IUPAC name of tricyclo[6.3.3.01,8]tetradecane-10,13-dione (CID 2817973) is tricyclo[6.3.3.01,8]tetradecane-10,13-dione.
What is the SMILES notation for tricyclo[6.3.3.01,8]tetradecane-10,13-dione?
The canonical SMILES for tricyclo[6.3.3.01,8]tetradecane-10,13-dione is O=C1CC23CCCCCCC2(C1)CC(=O)C3.
What is the InChIKey of tricyclo[6.3.3.01,8]tetradecane-10,13-dione?
The InChIKey is PCXASZHJUJHLRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c15-11-7-13-5-3-1-2-4-6-14(13,9-11)10-12(16)8-13/h1-10H2.
What are the key properties of tricyclo[6.3.3.01,8]tetradecane-10,13-dione?
tricyclo[6.3.3.01,8]tetradecane-10,13-dione has a molecular weight of 220.31 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.3.3.01,8]tetradecane-10,13-dione is sourced from PubChem (CID 2817973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).