About pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone
pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone (PubChem CID 2817988) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone.
Molecular Properties
| Compound Name | pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone |
| PubChem CID | 2817988 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone |
| SMILES | O=C(N1CCCC1)C12CC3CCC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H25NO/c18-15(17-5-1-2-6-17)16-9-12-3-4-13(10-16)8-14(7-12)11-16/h12-14H,1-11H2 |
| InChIKey | WTEZNGNNKSPVCQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone?
The IUPAC name of pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone (CID 2817988) is pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone.
What is the SMILES notation for pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone?
The canonical SMILES for pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone is O=C(N1CCCC1)C12CC3CCC(CC(C3)C1)C2.
What is the InChIKey of pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone?
The InChIKey is WTEZNGNNKSPVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO/c18-15(17-5-1-2-6-17)16-9-12-3-4-13(10-16)8-14(7-12)11-16/h12-14H,1-11H2.
What are the key properties of pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone?
pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone has a molecular weight of 247.38 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl(1-tricyclo[4.3.1.13,8]undecanyl)methanone is sourced from PubChem (CID 2817988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).