About 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene
2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene (PubChem CID 2818077) has the molecular formula C28H42O
and a molecular weight of 394.64 g/mol. Its IUPAC name is 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene |
| PubChem CID | 2818077 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H42O/c1-25(2,3)19-13-15-23(21(17-19)27(7,8)9)29-24-16-14-20(26(4,5)6)18-22(24)28(10,11)12/h13-18H,1-12H3 |
| InChIKey | QOCLRPMIJGICFT-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene?
The IUPAC name of 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene (CID 2818077) is 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene.
What is the SMILES notation for 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene?
The canonical SMILES for 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene is CC(C)(C)c1ccc(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1.
What is the InChIKey of 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene?
The InChIKey is QOCLRPMIJGICFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H42O/c1-25(2,3)19-13-15-23(21(17-19)27(7,8)9)29-24-16-14-20(26(4,5)6)18-22(24)28(10,11)12/h13-18H,1-12H3.
What are the key properties of 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene?
2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene has a molecular weight of 394.64 g/mol, XLogP of 8.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene is sourced from PubChem (CID 2818077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).