About 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one
1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 2818272) has the molecular formula C15H12ClNO
and a molecular weight of 257.72 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one |
| PubChem CID | 2818272 |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | O=C1Cc2ccccc2C(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C15H12ClNO/c16-12-7-5-10(6-8-12)15-13-4-2-1-3-11(13)9-14(18)17-15/h1-8,15H,9H2,(H,17,18) |
| InChIKey | FKGZGLJTVBJZBZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one?
The IUPAC name of 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one (CID 2818272) is 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one.
What is the SMILES notation for 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one?
The canonical SMILES for 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one is O=C1Cc2ccccc2C(c2ccc(Cl)cc2)N1.
What is the InChIKey of 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one?
The InChIKey is FKGZGLJTVBJZBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClNO/c16-12-7-5-10(6-8-12)15-13-4-2-1-3-11(13)9-14(18)17-15/h1-8,15H,9H2,(H,17,18).
What are the key properties of 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one?
1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one has a molecular weight of 257.72 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one is sourced from PubChem (CID 2818272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).