About N-(4-methylphenyl)-1,1-dioxothiolan-3-amine
N-(4-methylphenyl)-1,1-dioxothiolan-3-amine (PubChem CID 2818402) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is N-(4-methylphenyl)-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-(4-methylphenyl)-1,1-dioxothiolan-3-amine |
| PubChem CID | 2818402 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-(4-methylphenyl)-1,1-dioxothiolan-3-amine |
| SMILES | Cc1ccc(NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H15NO2S/c1-9-2-4-10(5-3-9)12-11-6-7-15(13,14)8-11/h2-5,11-12H,6-8H2,1H3 |
| InChIKey | OYIYNRJSSMVTOA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-methylphenyl)-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylphenyl)-1,1-dioxothiolan-3-amine?
The IUPAC name of N-(4-methylphenyl)-1,1-dioxothiolan-3-amine (CID 2818402) is N-(4-methylphenyl)-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-(4-methylphenyl)-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-(4-methylphenyl)-1,1-dioxothiolan-3-amine is Cc1ccc(NC2CCS(=O)(=O)C2)cc1.
What is the InChIKey of N-(4-methylphenyl)-1,1-dioxothiolan-3-amine?
The InChIKey is OYIYNRJSSMVTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-9-2-4-10(5-3-9)12-11-6-7-15(13,14)8-11/h2-5,11-12H,6-8H2,1H3.
What are the key properties of N-(4-methylphenyl)-1,1-dioxothiolan-3-amine?
N-(4-methylphenyl)-1,1-dioxothiolan-3-amine has a molecular weight of 225.31 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylphenyl)-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 2818402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).