C18H23NS — CID 2818586
2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]aniline (PubChem CID 2818586) has the molecular formula C18H23NS and a molecular weight of 285.46 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]aniline.
| Compound Name | 2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 2818586 |
| Molecular Formula | C18H23NS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]aniline |
| SMILES | Cc1c(C)c(C)c(CSc2ccccc2N)c(C)c1C |
| InChI | InChI=1S/C18H23NS/c1-11-12(2)14(4)16(15(5)13(11)3)10-20-18-9-7-6-8-17(18)19/h6-9H,10,19H2,1-5H3 |
| InChIKey | FJSNGNBRXMOKHD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|