C25H33ClN2O3S — CID 2818613
(2,3,4,5,6-pentamethylphenyl)methyl N-(4-chloro-2,5-dimethoxyphenyl)morpholine-4-carboximidothioate (PubChem CID 2818613) has the molecular formula C25H33ClN2O3S and a molecular weight of 477.07 g/mol. Its IUPAC name is (2,3,4,5,6-pentamethylphenyl)methyl N-(4-chloro-2,5-dimethoxyphenyl)morpholine-4-carboximidothioate.
| Compound Name | (2,3,4,5,6-pentamethylphenyl)methyl N-(4-chloro-2,5-dimethoxyphenyl)morpholine-4-carboximidothioate |
|---|---|
| PubChem CID | 2818613 |
| Molecular Formula | C25H33ClN2O3S |
| Molecular Weight | 477.07 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (2,3,4,5,6-pentamethylphenyl)methyl N-(4-chloro-2,5-dimethoxyphenyl)morpholine-4-carboximidothioate |
| SMILES | COc1cc(/N=C(/SCc2c(C)c(C)c(C)c(C)c2C)N2CCOCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C25H33ClN2O3S/c1-15-16(2)18(4)20(19(5)17(15)3)14-32-25(28-8-10-31-11-9-28)27-22-13-23(29-6)21(26)12-24(22)30-7/h12-13H,8-11,14H2,1-7H3/b27-25+ |
| InChIKey | TXVJZQLHORJIKQ-IMVLJIQESA-N |
| XLogP | 6.15 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.07 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|