C14H11Cl2N3O2 — CID 2818710
N'-(2,4-dichlorophenyl)-N-(pyridin-3-ylmethyl)oxamide (PubChem CID 2818710) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is N'-(2,4-dichlorophenyl)-N-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-(2,4-dichlorophenyl)-N-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 2818710 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | N'-(2,4-dichlorophenyl)-N-(pyridin-3-ylmethyl)oxamide |
| SMILES | O=C(NCc1cccnc1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2N3O2/c15-10-3-4-12(11(16)6-10)19-14(21)13(20)18-8-9-2-1-5-17-7-9/h1-7H,8H2,(H,18,20)(H,19,21) |
| InChIKey | OVNMNXKDKUAIFZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|