About N-benzyl-N'-(3-methylsulfanylphenyl)oxamide
N-benzyl-N'-(3-methylsulfanylphenyl)oxamide (PubChem CID 2818729) has the molecular formula C16H16N2O2S
and a molecular weight of 300.38 g/mol. Its IUPAC name is N-benzyl-N'-(3-methylsulfanylphenyl)oxamide.
Molecular Properties
| Compound Name | N-benzyl-N'-(3-methylsulfanylphenyl)oxamide |
| PubChem CID | 2818729 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-benzyl-N'-(3-methylsulfanylphenyl)oxamide |
| SMILES | CSc1cccc(NC(=O)C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O2S/c1-21-14-9-5-8-13(10-14)18-16(20)15(19)17-11-12-6-3-2-4-7-12/h2-10H,11H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | IYDDZLXNDVJJGW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-(3-methylsulfanylphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-(3-methylsulfanylphenyl)oxamide?
The IUPAC name of N-benzyl-N'-(3-methylsulfanylphenyl)oxamide (CID 2818729) is N-benzyl-N'-(3-methylsulfanylphenyl)oxamide.
What is the SMILES notation for N-benzyl-N'-(3-methylsulfanylphenyl)oxamide?
The canonical SMILES for N-benzyl-N'-(3-methylsulfanylphenyl)oxamide is CSc1cccc(NC(=O)C(=O)NCc2ccccc2)c1.
What is the InChIKey of N-benzyl-N'-(3-methylsulfanylphenyl)oxamide?
The InChIKey is IYDDZLXNDVJJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S/c1-21-14-9-5-8-13(10-14)18-16(20)15(19)17-11-12-6-3-2-4-7-12/h2-10H,11H2,1H3,(H,17,19)(H,18,20).
What are the key properties of N-benzyl-N'-(3-methylsulfanylphenyl)oxamide?
N-benzyl-N'-(3-methylsulfanylphenyl)oxamide has a molecular weight of 300.38 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-(3-methylsulfanylphenyl)oxamide is sourced from PubChem (CID 2818729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).