About N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide
N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide (PubChem CID 2818790) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide |
| PubChem CID | 2818790 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)n(C)n1 |
| InChI | InChI=1S/C10H17N3O/c1-7-6-8(13(5)12-7)11-9(14)10(2,3)4/h6H,1-5H3,(H,11,14) |
| InChIKey | BBGAMWFIEHDYMO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide?
The IUPAC name of N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide (CID 2818790) is N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide is Cc1cc(NC(=O)C(C)(C)C)n(C)n1.
What is the InChIKey of N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide?
The InChIKey is BBGAMWFIEHDYMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-7-6-8(13(5)12-7)11-9(14)10(2,3)4/h6H,1-5H3,(H,11,14).
What are the key properties of N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide?
N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide has a molecular weight of 195.27 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropanamide is sourced from PubChem (CID 2818790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).