C12H12ClN5 — CID 2818916
4-[(2-chlorophenyl)diazenyl]-5-cyclopropyl-1H-pyrazol-3-amine (PubChem CID 2818916) has the molecular formula C12H12ClN5 and a molecular weight of 261.72 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)diazenyl]-5-cyclopropyl-1H-pyrazol-3-amine.
| Compound Name | 4-[(2-chlorophenyl)diazenyl]-5-cyclopropyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 2818916 |
| Molecular Formula | C12H12ClN5 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-[(2-chlorophenyl)diazenyl]-5-cyclopropyl-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(C2CC2)c1/N=N/c1ccccc1Cl |
| InChI | InChI=1S/C12H12ClN5/c13-8-3-1-2-4-9(8)15-17-11-10(7-5-6-7)16-18-12(11)14/h1-4,7H,5-6H2,(H3,14,16,18)/b17-15+ |
| InChIKey | LHIPSNFVGAVHHV-BMRADRMJSA-N |
| XLogP | 3.94 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|