About 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine
2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 2818919) has the molecular formula C15H8F3N3S2
and a molecular weight of 351.38 g/mol. Its IUPAC name is 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine |
| PubChem CID | 2818919 |
| Molecular Formula | C15H8F3N3S2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | FC(F)(F)c1cc(-c2cccs2)nc2cc(-c3cccs3)nn12 |
| InChI | InChI=1S/C15H8F3N3S2/c16-15(17,18)13-7-9(11-3-1-5-22-11)19-14-8-10(20-21(13)14)12-4-2-6-23-12/h1-8H |
| InChIKey | PQOJHAATGCYINC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine?
The IUPAC name of 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine (CID 2818919) is 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine is FC(F)(F)c1cc(-c2cccs2)nc2cc(-c3cccs3)nn12.
What is the InChIKey of 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine?
The InChIKey is PQOJHAATGCYINC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F3N3S2/c16-15(17,18)13-7-9(11-3-1-5-22-11)19-14-8-10(20-21(13)14)12-4-2-6-23-12/h1-8H.
What are the key properties of 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine?
2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine has a molecular weight of 351.38 g/mol, XLogP of 5.21, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dithiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 2818919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).